C20H22N2O4 — CID 7901062
(4-methylphenyl) 4-[(3R)-3-methylpiperidin-1-yl]-3-nitrobenzoate (PubChem CID 7901062) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (4-methylphenyl) 4-[(3R)-3-methylpiperidin-1-yl]-3-nitrobenzoate.
| Compound Name | (4-methylphenyl) 4-[(3R)-3-methylpiperidin-1-yl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 7901062 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (4-methylphenyl) 4-[(3R)-3-methylpiperidin-1-yl]-3-nitrobenzoate |
| SMILES | Cc1ccc(OC(=O)c2ccc(N3CCC[C@@H](C)C3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H22N2O4/c1-14-5-8-17(9-6-14)26-20(23)16-7-10-18(19(12-16)22(24)25)21-11-3-4-15(2)13-21/h5-10,12,15H,3-4,11,13H2,1-2H3/t15-/m1/s1 |
| InChIKey | QACPSPJCIIIQOF-OAHLLOKOSA-N |
| XLogP | 4.36 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|