C21H23N5O5S — CID 46613921
(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 46613921) has the molecular formula C21H23N5O5S and a molecular weight of 457.51 g/mol. Its IUPAC name is (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 46613921 |
| Molecular Formula | C21H23N5O5S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | CCc1nn2c(=O)cc(COC(=O)c3ccc(N4CCCC(C)C4)c([N+](=O)[O-])c3)nc2s1 |
| InChI | InChI=1S/C21H23N5O5S/c1-3-18-23-25-19(27)10-15(22-21(25)32-18)12-31-20(28)14-6-7-16(17(9-14)26(29)30)24-8-4-5-13(2)11-24/h6-7,9-10,13H,3-5,8,11-12H2,1-2H3 |
| InChIKey | WOGNAHYENIBEOF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 119.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|