C21H21N5O5 — CID 4262572
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 4262572) has the molecular formula C21H21N5O5 and a molecular weight of 423.43 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 4262572 |
| Molecular Formula | C21H21N5O5 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | CC1CCCN(c2ccc(C(=O)OCn3nnc4ccccc4c3=O)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C21H21N5O5/c1-14-5-4-10-24(12-14)18-9-8-15(11-19(18)26(29)30)21(28)31-13-25-20(27)16-6-2-3-7-17(16)22-23-25/h2-3,6-9,11,14H,4-5,10,12-13H2,1H3 |
| InChIKey | QMASIKXTDLPMTQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 120.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|