About (5-methyl-1,2-oxazol-3-yl)methyl 3-fluoro-4-methylbenzoate
(5-methyl-1,2-oxazol-3-yl)methyl 3-fluoro-4-methylbenzoate (PubChem CID 52515134) has the molecular formula C13H12FNO3
and a molecular weight of 249.24 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)methyl 3-fluoro-4-methylbenzoate.
Analyze (5-methyl-1,2-oxazol-3-yl)methyl 3-fluoro-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,2-oxazol-3-yl)methyl 3-fluoro-4-methylbenzoate?
The IUPAC name of (5-methyl-1,2-oxazol-3-yl)methyl 3-fluoro-4-methylbenzoate (CID 52515134) is (5-methyl-1,2-oxazol-3-yl)methyl 3-fluoro-4-methylbenzoate.
What is the SMILES notation for (5-methyl-1,2-oxazol-3-yl)methyl 3-fluoro-4-methylbenzoate?
The canonical SMILES for (5-methyl-1,2-oxazol-3-yl)methyl 3-fluoro-4-methylbenzoate is Cc1cc(COC(=O)c2ccc(C)c(F)c2)no1.
What is the InChIKey of (5-methyl-1,2-oxazol-3-yl)methyl 3-fluoro-4-methylbenzoate?
The InChIKey is FEAOZCPGXUYXDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FNO3/c1-8-3-4-10(6-12(8)14)13(16)17-7-11-5-9(2)18-15-11/h3-6H,7H2,1-2H3.
What are the key properties of (5-methyl-1,2-oxazol-3-yl)methyl 3-fluoro-4-methylbenzoate?
(5-methyl-1,2-oxazol-3-yl)methyl 3-fluoro-4-methylbenzoate has a molecular weight of 249.24 g/mol, XLogP of 2.79, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,2-oxazol-3-yl)methyl 3-fluoro-4-methylbenzoate is sourced from PubChem (CID 52515134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).