(5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate

C14H16N2O5S — CID 8865947

IUPAC(5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate
SMILESCc1cc(COC(=O)c2cccc(S(=O)(=O)N(C)C)c2)no1
InChIInChI=1S/C14H16N2O5S/c1-10-7-12(15-21-10)9-20-14(17)11-5-4-6-13(8-11)22(18,19)16(2)3/h4-8H,9H2,1-3H3
InChIKeyAAGCEBCPVWZJTE-UHFFFAOYSA-N
MW324.36 g/mol
LogP1.59
Rot. Bonds5

About (5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate

(5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate (PubChem CID 8865947) has the molecular formula C14H16N2O5S and a molecular weight of 324.36 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate.

Molecular Properties

Compound Name(5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate
PubChem CID8865947
Molecular FormulaC14H16N2O5S
Molecular Weight324.36 g/mol
Exact Mass324.08
IUPAC Name(5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate
SMILESCc1cc(COC(=O)c2cccc(S(=O)(=O)N(C)C)c2)no1
InChIInChI=1S/C14H16N2O5S/c1-10-7-12(15-21-10)9-20-14(17)11-5-4-6-13(8-11)22(18,19)16(2)3/h4-8H,9H2,1-3H3
InChIKeyAAGCEBCPVWZJTE-UHFFFAOYSA-N
XLogP1.59
TPSA89.71 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500324.36
LogP ≤ 51.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze (5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate?
The IUPAC name of (5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate (CID 8865947) is (5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate.
What is the SMILES notation for (5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate?
The canonical SMILES for (5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate is Cc1cc(COC(=O)c2cccc(S(=O)(=O)N(C)C)c2)no1.
What is the InChIKey of (5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate?
The InChIKey is AAGCEBCPVWZJTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O5S/c1-10-7-12(15-21-10)9-20-14(17)11-5-4-6-13(8-11)22(18,19)16(2)3/h4-8H,9H2,1-3H3.
What are the key properties of (5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate?
(5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate has a molecular weight of 324.36 g/mol, XLogP of 1.59, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate is sourced from PubChem (CID 8865947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).