C14H16N2O5S — CID 8865947
(5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate (PubChem CID 8865947) has the molecular formula C14H16N2O5S and a molecular weight of 324.36 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate.
| Compound Name | (5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8865947 |
| Molecular Formula | C14H16N2O5S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)methyl 3-(dimethylsulfamoyl)benzoate |
| SMILES | Cc1cc(COC(=O)c2cccc(S(=O)(=O)N(C)C)c2)no1 |
| InChI | InChI=1S/C14H16N2O5S/c1-10-7-12(15-21-10)9-20-14(17)11-5-4-6-13(8-11)22(18,19)16(2)3/h4-8H,9H2,1-3H3 |
| InChIKey | AAGCEBCPVWZJTE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |