C20H19NO7S — CID 7960565
(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 3-(dimethylsulfamoyl)benzoate (PubChem CID 7960565) has the molecular formula C20H19NO7S and a molecular weight of 417.44 g/mol. Its IUPAC name is (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 3-(dimethylsulfamoyl)benzoate.
| Compound Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7960565 |
| Molecular Formula | C20H19NO7S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 3-(dimethylsulfamoyl)benzoate |
| SMILES | Cc1c(O)ccc2c(COC(=O)c3cccc(S(=O)(=O)N(C)C)c3)cc(=O)oc12 |
| InChI | InChI=1S/C20H19NO7S/c1-12-17(22)8-7-16-14(10-18(23)28-19(12)16)11-27-20(24)13-5-4-6-15(9-13)29(25,26)21(2)3/h4-10,22H,11H2,1-3H3 |
| InChIKey | PEGCDXSAJXCWBH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|