C21H15NO6 — CID 8789210
(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 2-oxo-1H-quinoline-4-carboxylate (PubChem CID 8789210) has the molecular formula C21H15NO6 and a molecular weight of 377.35 g/mol. Its IUPAC name is (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 2-oxo-1H-quinoline-4-carboxylate.
| Compound Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 2-oxo-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 8789210 |
| Molecular Formula | C21H15NO6 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 2-oxo-1H-quinoline-4-carboxylate |
| SMILES | Cc1c(O)ccc2c(COC(=O)c3cc(=O)[nH]c4ccccc34)cc(=O)oc12 |
| InChI | InChI=1S/C21H15NO6/c1-11-17(23)7-6-13-12(8-19(25)28-20(11)13)10-27-21(26)15-9-18(24)22-16-5-3-2-4-14(15)16/h2-9,23H,10H2,1H3,(H,22,24) |
| InChIKey | PCGYRBKABPTJTI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|