C22H17NO6 — CID 8853364
(2-ethoxycarbonyl-1-benzofuran-3-yl)methyl 2-oxo-1H-quinoline-4-carboxylate (PubChem CID 8853364) has the molecular formula C22H17NO6 and a molecular weight of 391.38 g/mol. Its IUPAC name is (2-ethoxycarbonyl-1-benzofuran-3-yl)methyl 2-oxo-1H-quinoline-4-carboxylate.
| Compound Name | (2-ethoxycarbonyl-1-benzofuran-3-yl)methyl 2-oxo-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 8853364 |
| Molecular Formula | C22H17NO6 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (2-ethoxycarbonyl-1-benzofuran-3-yl)methyl 2-oxo-1H-quinoline-4-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1COC(=O)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H17NO6/c1-2-27-22(26)20-16(14-8-4-6-10-18(14)29-20)12-28-21(25)15-11-19(24)23-17-9-5-3-7-13(15)17/h3-11H,2,12H2,1H3,(H,23,24) |
| InChIKey | GGKGDJUDHMKIEM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |