C20H18O6S — CID 11927023
ethyl 3-[[2-[(S)-methylsulfinyl]benzoyl]oxymethyl]-1-benzofuran-2-carboxylate (PubChem CID 11927023) has the molecular formula C20H18O6S and a molecular weight of 386.43 g/mol. Its IUPAC name is ethyl 3-[[2-[(S)-methylsulfinyl]benzoyl]oxymethyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-[[2-[(S)-methylsulfinyl]benzoyl]oxymethyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 11927023 |
| Molecular Formula | C20H18O6S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | ethyl 3-[[2-[(S)-methylsulfinyl]benzoyl]oxymethyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1COC(=O)c1ccccc1[S@](C)=O |
| InChI | InChI=1S/C20H18O6S/c1-3-24-20(22)18-15(13-8-4-6-10-16(13)26-18)12-25-19(21)14-9-5-7-11-17(14)27(2)23/h4-11H,3,12H2,1-2H3/t27-/m0/s1 |
| InChIKey | NGAYUMXTFJRSDD-MHZLTWQESA-N |
| XLogP | 3.70 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |