C19H14ClFO5 — CID 16560216
ethyl 3-[(2-chloro-4-fluorobenzoyl)oxymethyl]-1-benzofuran-2-carboxylate (PubChem CID 16560216) has the molecular formula C19H14ClFO5 and a molecular weight of 376.77 g/mol. Its IUPAC name is ethyl 3-[(2-chloro-4-fluorobenzoyl)oxymethyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-[(2-chloro-4-fluorobenzoyl)oxymethyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 16560216 |
| Molecular Formula | C19H14ClFO5 |
| Molecular Weight | 376.77 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | ethyl 3-[(2-chloro-4-fluorobenzoyl)oxymethyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1COC(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C19H14ClFO5/c1-2-24-19(23)17-14(12-5-3-4-6-16(12)26-17)10-25-18(22)13-8-7-11(21)9-15(13)20/h3-9H,2,10H2,1H3 |
| InChIKey | NFBUNXAELGCEIB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.77 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |