C22H17NO5S — CID 8724539
(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 8724539) has the molecular formula C22H17NO5S and a molecular weight of 407.45 g/mol. Its IUPAC name is (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate.
| Compound Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 8724539 |
| Molecular Formula | C22H17NO5S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)OCc1cc(=O)oc2c(C)c(O)ccc12 |
| InChI | InChI=1S/C22H17NO5S/c1-12-17(24)9-8-16-15(10-18(25)28-19(12)16)11-27-22(26)20-13(2)23-21(29-20)14-6-4-3-5-7-14/h3-10,24H,11H2,1-2H3 |
| InChIKey | KATJLNQSTWJHII-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|