C23H20O7 — CID 7960824
(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 3-(ethoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 7960824) has the molecular formula C23H20O7 and a molecular weight of 408.41 g/mol. Its IUPAC name is (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 3-(ethoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 3-(ethoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7960824 |
| Molecular Formula | C23H20O7 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 3-(ethoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | CCOCc1c(C(=O)OCc2cc(=O)oc3c(C)c(O)ccc23)oc2ccccc12 |
| InChI | InChI=1S/C23H20O7/c1-3-27-12-17-16-6-4-5-7-19(16)29-22(17)23(26)28-11-14-10-20(25)30-21-13(2)18(24)9-8-15(14)21/h4-10,24H,3,11-12H2,1-2H3 |
| InChIKey | CNMUFPBLTOUKKF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|