C22H17NO7 — CID 8926182
(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 8926182) has the molecular formula C22H17NO7 and a molecular weight of 407.38 g/mol. Its IUPAC name is (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 8926182 |
| Molecular Formula | C22H17NO7 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1c(O)ccc2c(COC(=O)[C@H](C)N3C(=O)c4ccccc4C3=O)cc(=O)oc12 |
| InChI | InChI=1S/C22H17NO7/c1-11-17(24)8-7-14-13(9-18(25)30-19(11)14)10-29-22(28)12(2)23-20(26)15-5-3-4-6-16(15)21(23)27/h3-9,12,24H,10H2,1-2H3/t12-/m0/s1 |
| InChIKey | MMMQYLCHIJBKBV-LBPRGKRZSA-N |
| XLogP | 2.53 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|