C24H21NO7S — CID 51486286
(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate (PubChem CID 51486286) has the molecular formula C24H21NO7S and a molecular weight of 467.50 g/mol. Its IUPAC name is (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate.
| Compound Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 51486286 |
| Molecular Formula | C24H21NO7S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](C(=O)OCc1cc(=O)oc2c(C)c(O)ccc12)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H21NO7S/c1-13-19(26)8-7-15-14(11-20(27)32-21(13)15)12-31-24(30)18(9-10-33-2)25-22(28)16-5-3-4-6-17(16)23(25)29/h3-8,11,18,26H,9-10,12H2,1-2H3/t18-/m0/s1 |
| InChIKey | LLHITCJPZKXCFF-SFHVURJKSA-N |
| XLogP | 3.27 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|