C19H23NO5S — CID 2441587
(3,3-dimethyl-2-oxobutyl) (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate (PubChem CID 2441587) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2441587 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](C(=O)OCC(=O)C(C)(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H23NO5S/c1-19(2,3)15(21)11-25-18(24)14(9-10-26-4)20-16(22)12-7-5-6-8-13(12)17(20)23/h5-8,14H,9-11H2,1-4H3/t14-/m1/s1 |
| InChIKey | QKJQPPRPDZIUCI-CQSZACIVSA-N |
| XLogP | 2.56 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|