C17H19N3O6S — CID 9328276
[(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate (PubChem CID 9328276) has the molecular formula C17H19N3O6S and a molecular weight of 393.42 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate.
| Compound Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 9328276 |
| Molecular Formula | C17H19N3O6S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](C(=O)O[C@@H](C)C(=O)NC(N)=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H19N3O6S/c1-9(13(21)19-17(18)25)26-16(24)12(7-8-27-2)20-14(22)10-5-3-4-6-11(10)15(20)23/h3-6,9,12H,7-8H2,1-2H3,(H3,18,19,21,25)/t9-,12+/m0/s1 |
| InChIKey | SXEVNZYYNXDIEL-JOYOIKCWSA-N |
| XLogP | 0.53 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|