C24H25N3O6S — CID 2374431
[(2S)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate (PubChem CID 2374431) has the molecular formula C24H25N3O6S and a molecular weight of 483.55 g/mol. Its IUPAC name is [(2S)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate.
| Compound Name | [(2S)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2374431 |
| Molecular Formula | C24H25N3O6S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | [(2S)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](C(=O)O[C@@H](C)C(=O)Nc1ccc(NC(C)=O)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H25N3O6S/c1-14(21(29)26-17-10-8-16(9-11-17)25-15(2)28)33-24(32)20(12-13-34-3)27-22(30)18-6-4-5-7-19(18)23(27)31/h4-11,14,20H,12-13H2,1-3H3,(H,25,28)(H,26,29)/t14-,20+/m0/s1 |
| InChIKey | WJGKGZXIZFNMEM-VBKZILBWSA-N |
| XLogP | 2.93 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|