C20H17N2O5S- — CID 9454248
4-[[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoyl]amino]benzoate (PubChem CID 9454248) has the molecular formula C20H17N2O5S- and a molecular weight of 397.43 g/mol. Its IUPAC name is 4-[[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoyl]amino]benzoate.
| Compound Name | 4-[[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoyl]amino]benzoate |
|---|---|
| PubChem CID | 9454248 |
| Molecular Formula | C20H17N2O5S- |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 4-[[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoyl]amino]benzoate |
| SMILES | CSCC[C@H](C(=O)Nc1ccc(C(=O)[O-])cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H18N2O5S/c1-28-11-10-16(17(23)21-13-8-6-12(7-9-13)20(26)27)22-18(24)14-4-2-3-5-15(14)19(22)25/h2-9,16H,10-11H2,1H3,(H,21,23)(H,26,27)/p-1/t16-/m1/s1 |
| InChIKey | PAGYUYPIRAOYSF-MRXNPFEDSA-M |
| XLogP | 1.41 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|