C21H21N3O4S — CID 9451739
3-[[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoyl]amino]-N-methylbenzamide (PubChem CID 9451739) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is 3-[[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoyl]amino]-N-methylbenzamide.
| Compound Name | 3-[[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 9451739 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 3-[[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)[C@@H](CCSC)N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C21H21N3O4S/c1-22-18(25)13-6-5-7-14(12-13)23-19(26)17(10-11-29-2)24-20(27)15-8-3-4-9-16(15)21(24)28/h3-9,12,17H,10-11H2,1-2H3,(H,22,25)(H,23,26)/t17-/m1/s1 |
| InChIKey | GKOPWQDZFOXDEY-QGZVFWFLSA-N |
| XLogP | 2.40 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|