C23H24N2O5S — CID 18208621
propyl 4-[[2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoyl]amino]benzoate (PubChem CID 18208621) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is propyl 4-[[2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoyl]amino]benzoate.
| Compound Name | propyl 4-[[2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoyl]amino]benzoate |
|---|---|
| PubChem CID | 18208621 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | propyl 4-[[2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)C(CCSC)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H24N2O5S/c1-3-13-30-23(29)15-8-10-16(11-9-15)24-20(26)19(12-14-31-2)25-21(27)17-6-4-5-7-18(17)22(25)28/h4-11,19H,3,12-14H2,1-2H3,(H,24,26) |
| InChIKey | RKOOXLDRBRBLFY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|