C24H26N2O6 — CID 19169319
2-methoxyethyl 4-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]benzoate (PubChem CID 19169319) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-methoxyethyl 4-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]benzoate.
| Compound Name | 2-methoxyethyl 4-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 19169319 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-methoxyethyl 4-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]benzoate |
| SMILES | COCCOC(=O)c1ccc(NC(=O)C(CC(C)C)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H26N2O6/c1-15(2)14-20(26-22(28)18-6-4-5-7-19(18)23(26)29)21(27)25-17-10-8-16(9-11-17)24(30)32-13-12-31-3/h4-11,15,20H,12-14H2,1-3H3,(H,25,27) |
| InChIKey | NUWRVPFOETWMQZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|