C23H23NO6 — CID 8000624
methyl 4-[[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]oxymethyl]benzoate (PubChem CID 8000624) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is methyl 4-[[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]oxymethyl]benzoate.
| Compound Name | methyl 4-[[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 8000624 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | methyl 4-[[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(COC(=O)[C@@H](CC(C)C)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H23NO6/c1-14(2)12-19(24-20(25)17-6-4-5-7-18(17)21(24)26)23(28)30-13-15-8-10-16(11-9-15)22(27)29-3/h4-11,14,19H,12-13H2,1-3H3/t19-/m1/s1 |
| InChIKey | QHFQGQSNKXTIPN-LJQANCHMSA-N |
| XLogP | 3.23 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|