C22H20N2O4 — CID 7951866
(4-cyanophenyl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate (PubChem CID 7951866) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is (4-cyanophenyl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate.
| Compound Name | (4-cyanophenyl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 7951866 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (4-cyanophenyl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](C(=O)OCc1ccc(C#N)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H20N2O4/c1-14(2)11-19(22(27)28-13-16-9-7-15(12-23)8-10-16)24-20(25)17-5-3-4-6-18(17)21(24)26/h3-10,14,19H,11,13H2,1-2H3/t19-/m0/s1 |
| InChIKey | HWLPNUJTYBIPRX-IBGZPJMESA-N |
| XLogP | 3.31 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|