C25H28N2O5 — CID 19167960
butyl 3-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]benzoate (PubChem CID 19167960) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is butyl 3-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]benzoate.
| Compound Name | butyl 3-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 19167960 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | butyl 3-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cccc(NC(=O)C(CC(C)C)N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C25H28N2O5/c1-4-5-13-32-25(31)17-9-8-10-18(15-17)26-22(28)21(14-16(2)3)27-23(29)19-11-6-7-12-20(19)24(27)30/h6-12,15-16,21H,4-5,13-14H2,1-3H3,(H,26,28) |
| InChIKey | CXLMSSRWKROMNI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|