C24H22N2O3 — CID 4070544
2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-naphthalen-2-ylpentanamide (PubChem CID 4070544) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-naphthalen-2-ylpentanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-naphthalen-2-ylpentanamide |
|---|---|
| PubChem CID | 4070544 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-naphthalen-2-ylpentanamide |
| SMILES | CC(C)CC(C(=O)Nc1ccc2ccccc2c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H22N2O3/c1-15(2)13-21(26-23(28)19-9-5-6-10-20(19)24(26)29)22(27)25-18-12-11-16-7-3-4-8-17(16)14-18/h3-12,14-15,21H,13H2,1-2H3,(H,25,27) |
| InChIKey | ZRZHVCAQBTVEFC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|