C21H20N2O5 — CID 2303089
(2R)-N-(1,3-benzodioxol-5-yl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide (PubChem CID 2303089) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is (2R)-N-(1,3-benzodioxol-5-yl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide.
| Compound Name | (2R)-N-(1,3-benzodioxol-5-yl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 2303089 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (2R)-N-(1,3-benzodioxol-5-yl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](C(=O)Nc1ccc2c(c1)OCO2)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H20N2O5/c1-12(2)9-16(23-20(25)14-5-3-4-6-15(14)21(23)26)19(24)22-13-7-8-17-18(10-13)28-11-27-17/h3-8,10,12,16H,9,11H2,1-2H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | VLAMIGHVBJABBS-MRXNPFEDSA-N |
| XLogP | 3.06 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|