C22H22F2N2O5 — CID 55540035
N-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide (PubChem CID 55540035) has the molecular formula C22H22F2N2O5 and a molecular weight of 432.42 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide.
| Compound Name | N-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 55540035 |
| Molecular Formula | C22H22F2N2O5 |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide |
| SMILES | COc1ccc(NC(=O)C(CC(C)C)N2C(=O)c3ccccc3C2=O)cc1OC(F)F |
| InChI | InChI=1S/C22H22F2N2O5/c1-12(2)10-16(26-20(28)14-6-4-5-7-15(14)21(26)29)19(27)25-13-8-9-17(30-3)18(11-13)31-22(23)24/h4-9,11-12,16,22H,10H2,1-3H3,(H,25,27) |
| InChIKey | URXQIGFLFVSELA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|