C24H28N2O6 — CID 86776780
2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(2,4,6-trimethoxyphenyl)methyl]pentanamide (PubChem CID 86776780) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(2,4,6-trimethoxyphenyl)methyl]pentanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(2,4,6-trimethoxyphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 86776780 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(2,4,6-trimethoxyphenyl)methyl]pentanamide |
| SMILES | COc1cc(OC)c(CNC(=O)C(CC(C)C)N2C(=O)c3ccccc3C2=O)c(OC)c1 |
| InChI | InChI=1S/C24H28N2O6/c1-14(2)10-19(26-23(28)16-8-6-7-9-17(16)24(26)29)22(27)25-13-18-20(31-4)11-15(30-3)12-21(18)32-5/h6-9,11-12,14,19H,10,13H2,1-5H3,(H,25,27) |
| InChIKey | HKLPGPZRAFKCMB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|