C27H27N3O4 — CID 46487631
2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]pentanamide (PubChem CID 46487631) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]pentanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 46487631 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]pentanamide |
| SMILES | CC(C)CC(C(=O)NCc1cccc(OCc2ccccn2)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H27N3O4/c1-18(2)14-24(30-26(32)22-11-3-4-12-23(22)27(30)33)25(31)29-16-19-8-7-10-21(15-19)34-17-20-9-5-6-13-28-20/h3-13,15,18,24H,14,16-17H2,1-2H3,(H,29,31) |
| InChIKey | IYDPHIYBNXPDFZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|