C19H24N2O3 — CID 4547476
N-cyclopentyl-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide (PubChem CID 4547476) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-cyclopentyl-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide.
| Compound Name | N-cyclopentyl-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 4547476 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-cyclopentyl-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide |
| SMILES | CC(C)CC(C(=O)NC1CCCC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H24N2O3/c1-12(2)11-16(17(22)20-13-7-3-4-8-13)21-18(23)14-9-5-6-10-15(14)19(21)24/h5-6,9-10,12-13,16H,3-4,7-8,11H2,1-2H3,(H,20,22) |
| InChIKey | ABXBILGMASZJJX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|