C22H29N3O4 — CID 110347576
2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]pentanamide (PubChem CID 110347576) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]pentanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]pentanamide |
|---|---|
| PubChem CID | 110347576 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]pentanamide |
| SMILES | CC(C)CC(C(=O)N[C@@H](C)C(=O)N1CCCCC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H29N3O4/c1-14(2)13-18(25-21(28)16-9-5-6-10-17(16)22(25)29)19(26)23-15(3)20(27)24-11-7-4-8-12-24/h5-6,9-10,14-15,18H,4,7-8,11-13H2,1-3H3,(H,23,26)/t15-,18?/m0/s1 |
| InChIKey | OGHQXDOGMIENHK-BUSXIPJBSA-N |
| XLogP | 2.21 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|