C26H30N2O3 — CID 118729481
2-[(2S)-1-(4-benzylpiperidin-1-yl)-4-methyl-1-oxopentan-2-yl]isoindole-1,3-dione (PubChem CID 118729481) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-[(2S)-1-(4-benzylpiperidin-1-yl)-4-methyl-1-oxopentan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-1-(4-benzylpiperidin-1-yl)-4-methyl-1-oxopentan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118729481 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 2-[(2S)-1-(4-benzylpiperidin-1-yl)-4-methyl-1-oxopentan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C)C[C@@H](C(=O)N1CCC(Cc2ccccc2)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H30N2O3/c1-18(2)16-23(28-24(29)21-10-6-7-11-22(21)25(28)30)26(31)27-14-12-20(13-15-27)17-19-8-4-3-5-9-19/h3-11,18,20,23H,12-17H2,1-2H3/t23-/m0/s1 |
| InChIKey | OFXMLMQDYGWYCA-QHCPKHFHSA-N |
| XLogP | 4.18 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|