C21H25NOS — CID 2575053
(2R)-1-(4-benzylpiperidin-1-yl)-2-phenylsulfanylpropan-1-one (PubChem CID 2575053) has the molecular formula C21H25NOS and a molecular weight of 339.50 g/mol. Its IUPAC name is (2R)-1-(4-benzylpiperidin-1-yl)-2-phenylsulfanylpropan-1-one.
| Compound Name | (2R)-1-(4-benzylpiperidin-1-yl)-2-phenylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 2575053 |
| Molecular Formula | C21H25NOS |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (2R)-1-(4-benzylpiperidin-1-yl)-2-phenylsulfanylpropan-1-one |
| SMILES | C[C@@H](Sc1ccccc1)C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H25NOS/c1-17(24-20-10-6-3-7-11-20)21(23)22-14-12-19(13-15-22)16-18-8-4-2-5-9-18/h2-11,17,19H,12-16H2,1H3/t17-/m1/s1 |
| InChIKey | ILOUOVMNNZUWGW-QGZVFWFLSA-N |
| XLogP | 4.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |