C22H31N5OS — CID 27047728
(2R)-1-(4-benzylpiperidin-1-yl)-2-(1-cyclohexyltetrazol-5-yl)sulfanylpropan-1-one (PubChem CID 27047728) has the molecular formula C22H31N5OS and a molecular weight of 413.59 g/mol. Its IUPAC name is (2R)-1-(4-benzylpiperidin-1-yl)-2-(1-cyclohexyltetrazol-5-yl)sulfanylpropan-1-one.
| Compound Name | (2R)-1-(4-benzylpiperidin-1-yl)-2-(1-cyclohexyltetrazol-5-yl)sulfanylpropan-1-one |
|---|---|
| PubChem CID | 27047728 |
| Molecular Formula | C22H31N5OS |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (2R)-1-(4-benzylpiperidin-1-yl)-2-(1-cyclohexyltetrazol-5-yl)sulfanylpropan-1-one |
| SMILES | C[C@@H](Sc1nnnn1C1CCCCC1)C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H31N5OS/c1-17(29-22-23-24-25-27(22)20-10-6-3-7-11-20)21(28)26-14-12-19(13-15-26)16-18-8-4-2-5-9-18/h2,4-5,8-9,17,19-20H,3,6-7,10-16H2,1H3/t17-/m1/s1 |
| InChIKey | IXXYVZKPHJPOJC-QGZVFWFLSA-N |
| XLogP | 4.14 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |