C15H18N6O2S — CID 27097053
(2S)-N-(benzylcarbamoyl)-2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanamide (PubChem CID 27097053) has the molecular formula C15H18N6O2S and a molecular weight of 346.42 g/mol. Its IUPAC name is (2S)-N-(benzylcarbamoyl)-2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanamide.
| Compound Name | (2S)-N-(benzylcarbamoyl)-2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 27097053 |
| Molecular Formula | C15H18N6O2S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (2S)-N-(benzylcarbamoyl)-2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanamide |
| SMILES | C[C@H](Sc1nnnn1C1CC1)C(=O)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C15H18N6O2S/c1-10(24-15-18-19-20-21(15)12-7-8-12)13(22)17-14(23)16-9-11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3,(H2,16,17,22,23)/t10-/m0/s1 |
| InChIKey | JXNSTSFUAGWLPD-JTQLQIEISA-N |
| XLogP | 1.51 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |