C15H20N6OS — CID 51097969
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-3-methyl-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 51097969) has the molecular formula C15H20N6OS and a molecular weight of 332.43 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-3-methyl-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-3-methyl-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 51097969 |
| Molecular Formula | C15H20N6OS |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-3-methyl-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | CC(C)C(Sc1nnnn1C1CC1)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C15H20N6OS/c1-10(2)13(14(22)17-9-11-4-3-7-16-8-11)23-15-18-19-20-21(15)12-5-6-12/h3-4,7-8,10,12-13H,5-6,9H2,1-2H3,(H,17,22) |
| InChIKey | WPLFUWHVRVPSHC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |