C18H26N6OS — CID 52508769
(2R)-2-(1-cyclohexyltetrazol-5-yl)sulfanyl-3-methyl-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 52508769) has the molecular formula C18H26N6OS and a molecular weight of 374.51 g/mol. Its IUPAC name is (2R)-2-(1-cyclohexyltetrazol-5-yl)sulfanyl-3-methyl-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | (2R)-2-(1-cyclohexyltetrazol-5-yl)sulfanyl-3-methyl-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 52508769 |
| Molecular Formula | C18H26N6OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (2R)-2-(1-cyclohexyltetrazol-5-yl)sulfanyl-3-methyl-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | CC(C)[C@@H](Sc1nnnn1C1CCCCC1)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C18H26N6OS/c1-13(2)16(17(25)20-12-14-7-6-10-19-11-14)26-18-21-22-23-24(18)15-8-4-3-5-9-15/h6-7,10-11,13,15-16H,3-5,8-9,12H2,1-2H3,(H,20,25)/t16-/m1/s1 |
| InChIKey | PFLRFFMNMRKYMR-MRXNPFEDSA-N |
| XLogP | 3.01 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |