C22H24N6O2S — CID 55541878
2-[2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanoylamino]-N-(2-phenylethyl)benzamide (PubChem CID 55541878) has the molecular formula C22H24N6O2S and a molecular weight of 436.54 g/mol. Its IUPAC name is 2-[2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanoylamino]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-[2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanoylamino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 55541878 |
| Molecular Formula | C22H24N6O2S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-[2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanoylamino]-N-(2-phenylethyl)benzamide |
| SMILES | CC(Sc1nnnn1C1CC1)C(=O)Nc1ccccc1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C22H24N6O2S/c1-15(31-22-25-26-27-28(22)17-11-12-17)20(29)24-19-10-6-5-9-18(19)21(30)23-14-13-16-7-3-2-4-8-16/h2-10,15,17H,11-14H2,1H3,(H,23,30)(H,24,29) |
| InChIKey | PTTDUOOFEDNYBF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |