C25H26N2O2S — CID 27055625
2-[[(2R)-2-(4-methylphenyl)sulfanylpropanoyl]amino]-N-(2-phenylethyl)benzamide (PubChem CID 27055625) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is 2-[[(2R)-2-(4-methylphenyl)sulfanylpropanoyl]amino]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-[[(2R)-2-(4-methylphenyl)sulfanylpropanoyl]amino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 27055625 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 2-[[(2R)-2-(4-methylphenyl)sulfanylpropanoyl]amino]-N-(2-phenylethyl)benzamide |
| SMILES | Cc1ccc(S[C@H](C)C(=O)Nc2ccccc2C(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H26N2O2S/c1-18-12-14-21(15-13-18)30-19(2)24(28)27-23-11-7-6-10-22(23)25(29)26-17-16-20-8-4-3-5-9-20/h3-15,19H,16-17H2,1-2H3,(H,26,29)(H,27,28)/t19-/m1/s1 |
| InChIKey | QHWONMQORWALDD-LJQANCHMSA-N |
| XLogP | 5.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |