C18H23N5O2S — CID 52518791
(2S)-N-(2-cyclopentyloxyphenyl)-2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanamide (PubChem CID 52518791) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is (2S)-N-(2-cyclopentyloxyphenyl)-2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanamide.
| Compound Name | (2S)-N-(2-cyclopentyloxyphenyl)-2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 52518791 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | (2S)-N-(2-cyclopentyloxyphenyl)-2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanamide |
| SMILES | C[C@H](Sc1nnnn1C1CC1)C(=O)Nc1ccccc1OC1CCCC1 |
| InChI | InChI=1S/C18H23N5O2S/c1-12(26-18-20-21-22-23(18)13-10-11-13)17(24)19-15-8-4-5-9-16(15)25-14-6-2-3-7-14/h4-5,8-9,12-14H,2-3,6-7,10-11H2,1H3,(H,19,24)/t12-/m0/s1 |
| InChIKey | FENAETBSAQRGKS-LBPRGKRZSA-N |
| XLogP | 3.45 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |