C20H29N6OS+ — CID 9461174
(2S)-1-(4-benzylpiperazin-4-ium-1-yl)-2-(1-cyclopentyltetrazol-5-yl)sulfanylpropan-1-one (PubChem CID 9461174) has the molecular formula C20H29N6OS+ and a molecular weight of 401.56 g/mol. Its IUPAC name is (2S)-1-(4-benzylpiperazin-4-ium-1-yl)-2-(1-cyclopentyltetrazol-5-yl)sulfanylpropan-1-one.
| Compound Name | (2S)-1-(4-benzylpiperazin-4-ium-1-yl)-2-(1-cyclopentyltetrazol-5-yl)sulfanylpropan-1-one |
|---|---|
| PubChem CID | 9461174 |
| Molecular Formula | C20H29N6OS+ |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | (2S)-1-(4-benzylpiperazin-4-ium-1-yl)-2-(1-cyclopentyltetrazol-5-yl)sulfanylpropan-1-one |
| SMILES | C[C@H](Sc1nnnn1C1CCCC1)C(=O)N1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H28N6OS/c1-16(28-20-21-22-23-26(20)18-9-5-6-10-18)19(27)25-13-11-24(12-14-25)15-17-7-3-2-4-8-17/h2-4,7-8,16,18H,5-6,9-15H2,1H3/p+1/t16-/m0/s1 |
| InChIKey | BRPZZCQZCABEAI-INIZCTEOSA-O |
| XLogP | 1.20 |
| TPSA | 68.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |