C18H23N5O2S — CID 9208040
(2R)-2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-morpholin-4-yl-2-phenylethanone (PubChem CID 9208040) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is (2R)-2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-morpholin-4-yl-2-phenylethanone.
| Compound Name | (2R)-2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-morpholin-4-yl-2-phenylethanone |
|---|---|
| PubChem CID | 9208040 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | (2R)-2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-morpholin-4-yl-2-phenylethanone |
| SMILES | O=C([C@H](Sc1nnnn1C1CCCC1)c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C18H23N5O2S/c24-17(22-10-12-25-13-11-22)16(14-6-2-1-3-7-14)26-18-19-20-21-23(18)15-8-4-5-9-15/h1-3,6-7,15-16H,4-5,8-13H2/t16-/m1/s1 |
| InChIKey | MISJYUIQKCSLFF-MRXNPFEDSA-N |
| XLogP | 2.48 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |