C13H14N6O2S — CID 9207001
(2R)-N-carbamoyl-2-(1-cyclopropyltetrazol-5-yl)sulfanyl-2-phenylacetamide (PubChem CID 9207001) has the molecular formula C13H14N6O2S and a molecular weight of 318.36 g/mol. Its IUPAC name is (2R)-N-carbamoyl-2-(1-cyclopropyltetrazol-5-yl)sulfanyl-2-phenylacetamide.
| Compound Name | (2R)-N-carbamoyl-2-(1-cyclopropyltetrazol-5-yl)sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 9207001 |
| Molecular Formula | C13H14N6O2S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (2R)-N-carbamoyl-2-(1-cyclopropyltetrazol-5-yl)sulfanyl-2-phenylacetamide |
| SMILES | NC(=O)NC(=O)[C@H](Sc1nnnn1C1CC1)c1ccccc1 |
| InChI | InChI=1S/C13H14N6O2S/c14-12(21)15-11(20)10(8-4-2-1-3-5-8)22-13-16-17-18-19(13)9-6-7-9/h1-5,9-10H,6-7H2,(H3,14,15,20,21)/t10-/m1/s1 |
| InChIKey | MMYOAJSKVGDYOI-SNVBAGLBSA-N |
| XLogP | 1.04 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |