C19H19N5O2S — CID 46645485
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(4-methoxyphenyl)-2-phenylacetamide (PubChem CID 46645485) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(4-methoxyphenyl)-2-phenylacetamide.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(4-methoxyphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 46645485 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(4-methoxyphenyl)-2-phenylacetamide |
| SMILES | COc1ccc(NC(=O)C(Sc2nnnn2C2CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19N5O2S/c1-26-16-11-7-14(8-12-16)20-18(25)17(13-5-3-2-4-6-13)27-19-21-22-23-24(19)15-9-10-15/h2-8,11-12,15,17H,9-10H2,1H3,(H,20,25) |
| InChIKey | FGTWDGKMGORXLE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |