C20H21N5OS — CID 51280082
2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N,2-diphenylacetamide (PubChem CID 51280082) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N,2-diphenylacetamide.
| Compound Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N,2-diphenylacetamide |
|---|---|
| PubChem CID | 51280082 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N,2-diphenylacetamide |
| SMILES | O=C(Nc1ccccc1)C(Sc1nnnn1C1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H21N5OS/c26-19(21-16-11-5-2-6-12-16)18(15-9-3-1-4-10-15)27-20-22-23-24-25(20)17-13-7-8-14-17/h1-6,9-12,17-18H,7-8,13-14H2,(H,21,26) |
| InChIKey | IEAJLYGUOZQLFF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |