C16H20N6O3S — CID 51258543
2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-(3-nitrophenyl)propanamide (PubChem CID 51258543) has the molecular formula C16H20N6O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is 2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-(3-nitrophenyl)propanamide.
| Compound Name | 2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-(3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 51258543 |
| Molecular Formula | C16H20N6O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-(3-nitrophenyl)propanamide |
| SMILES | CC(Sc1nnnn1C1CCCCC1)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H20N6O3S/c1-11(15(23)17-12-6-5-9-14(10-12)22(24)25)26-16-18-19-20-21(16)13-7-3-2-4-8-13/h5-6,9-11,13H,2-4,7-8H2,1H3,(H,17,23) |
| InChIKey | SGCPYPINSUZUKZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|