C17H16N6O4S — CID 5027055
2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-(3-nitrophenyl)propanamide (PubChem CID 5027055) has the molecular formula C17H16N6O4S and a molecular weight of 400.42 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-(3-nitrophenyl)propanamide.
| Compound Name | 2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-(3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 5027055 |
| Molecular Formula | C17H16N6O4S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-(3-nitrophenyl)propanamide |
| SMILES | COc1ccc(-n2nnnc2SC(C)C(=O)Nc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H16N6O4S/c1-11(16(24)18-12-4-3-5-14(10-12)23(25)26)28-17-19-20-21-22(17)13-6-8-15(27-2)9-7-13/h3-11H,1-2H3,(H,18,24) |
| InChIKey | ILXJEXAUSWRHOB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|