C16H15N7O3S2 — CID 46642116
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 46642116) has the molecular formula C16H15N7O3S2 and a molecular weight of 417.48 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 46642116 |
| Molecular Formula | C16H15N7O3S2 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | CC(Sc1nnnn1C1CC1)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C16H15N7O3S2/c1-9(28-16-19-20-21-22(16)11-5-6-11)14(24)18-15-17-13(8-27-15)10-3-2-4-12(7-10)23(25)26/h2-4,7-9,11H,5-6H2,1H3,(H,17,18,24) |
| InChIKey | IFQKMXXWRBRIPG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|