C17H19N7O3S2 — CID 55445067
2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 55445067) has the molecular formula C17H19N7O3S2 and a molecular weight of 433.52 g/mol. Its IUPAC name is 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 55445067 |
| Molecular Formula | C17H19N7O3S2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | CC(Sc1nnnn1C(C)(C)C)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C17H19N7O3S2/c1-10(29-16-20-21-22-23(16)17(2,3)4)14(25)19-15-18-13(9-28-15)11-6-5-7-12(8-11)24(26)27/h5-10H,1-4H3,(H,18,19,25) |
| InChIKey | GLHIWWOKEAWTID-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|