C15H12N4O3S3 — CID 60564202
N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-(1,3-thiazol-2-ylsulfanyl)propanamide (PubChem CID 60564202) has the molecular formula C15H12N4O3S3 and a molecular weight of 392.49 g/mol. Its IUPAC name is N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-(1,3-thiazol-2-ylsulfanyl)propanamide.
| Compound Name | N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-(1,3-thiazol-2-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 60564202 |
| Molecular Formula | C15H12N4O3S3 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-(1,3-thiazol-2-ylsulfanyl)propanamide |
| SMILES | CC(Sc1nccs1)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C15H12N4O3S3/c1-9(25-15-16-5-6-23-15)13(20)18-14-17-12(8-24-14)10-3-2-4-11(7-10)19(21)22/h2-9H,1H3,(H,17,18,20) |
| InChIKey | OQFUFHUUMCNRGU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|